C24H24N4O6S2 — CID 4194827
1,4-bis(benzenesulfonyl)-N-[(2-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide (PubChem CID 4194827) has the molecular formula C24H24N4O6S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-[(2-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-[(2-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 4194827 |
| Molecular Formula | C24H24N4O6S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-[(2-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1O)C1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O6S2/c29-23-14-8-7-9-19(23)17-25-26-24(30)22-18-27(35(31,32)20-10-3-1-4-11-20)15-16-28(22)36(33,34)21-12-5-2-6-13-21/h1-14,17,22,29H,15-16,18H2,(H,26,30) |
| InChIKey | IEQQVJJIQBUKKA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|