C30H30BrN5O5S2 — CID 99654968
(2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide (PubChem CID 99654968) has the molecular formula C30H30BrN5O5S2 and a molecular weight of 684.64 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 99654968 |
| Molecular Formula | C30H30BrN5O5S2 |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 683.09 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@H]2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H30BrN5O5S2/c1-22-19-24(23(2)36(22)26-15-13-25(31)14-16-26)20-32-33-30(37)29-21-34(42(38,39)27-9-5-3-6-10-27)17-18-35(29)43(40,41)28-11-7-4-8-12-28/h3-16,19-20,29H,17-18,21H2,1-2H3,(H,33,37)/b32-20-/t29-/m1/s1 |
| InChIKey | BWXHLDNGGPATLL-IFWJHDFLSA-N |
| XLogP | 4.07 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|