C20H23N3O4S — CID 135852699
(3S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 135852699) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is (3S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 135852699 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3S)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N/N=C/c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-15-8-10-18(11-9-15)28(26,27)23-12-4-6-17(14-23)20(25)22-21-13-16-5-2-3-7-19(16)24/h2-3,5,7-11,13,17,24H,4,6,12,14H2,1H3,(H,22,25)/b21-13+/t17-/m0/s1 |
| InChIKey | OBXUWGOIENYDNQ-RSZPVBOMSA-N |
| XLogP | 2.25 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|