C17H19N3O3S2 — CID 17349457
1-(benzenesulfonyl)-N-[(E)-thiophen-2-ylmethylideneamino]piperidine-3-carboxamide (PubChem CID 17349457) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[(E)-thiophen-2-ylmethylideneamino]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[(E)-thiophen-2-ylmethylideneamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 17349457 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[(E)-thiophen-2-ylmethylideneamino]piperidine-3-carboxamide |
| SMILES | O=C(N/N=C/c1cccs1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H19N3O3S2/c21-17(19-18-12-15-7-5-11-24-15)14-6-4-10-20(13-14)25(22,23)16-8-2-1-3-9-16/h1-3,5,7-9,11-12,14H,4,6,10,13H2,(H,19,21)/b18-12+ |
| InChIKey | DNTJAZGECICZCD-LDADJPATSA-N |
| XLogP | 2.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|