C18H19N3O2S — CID 126011112
1-benzoyl-N-[(Z)-thiophen-2-ylmethylideneamino]piperidine-4-carboxamide (PubChem CID 126011112) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-benzoyl-N-[(Z)-thiophen-2-ylmethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[(Z)-thiophen-2-ylmethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126011112 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-benzoyl-N-[(Z)-thiophen-2-ylmethylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccs1)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19N3O2S/c22-17(20-19-13-16-7-4-12-24-16)14-8-10-21(11-9-14)18(23)15-5-2-1-3-6-15/h1-7,12-14H,8-11H2,(H,20,22)/b19-13- |
| InChIKey | DGYYNLKXMKKBEB-UYRXBGFRSA-N |
| XLogP | 2.75 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|