C20H18Cl2FN3O2 — CID 126012282
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 126012282) has the molecular formula C20H18Cl2FN3O2 and a molecular weight of 422.29 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126012282 |
| Molecular Formula | C20H18Cl2FN3O2 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H18Cl2FN3O2/c21-17-2-1-3-18(22)16(17)12-24-25-19(27)13-8-10-26(11-9-13)20(28)14-4-6-15(23)7-5-14/h1-7,12-13H,8-11H2,(H,25,27)/b24-12- |
| InChIKey | JJYGSEFVYQKJCU-MSXFZWOLSA-N |
| XLogP | 4.14 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|