C21H19ClF3N3O2 — CID 126011452
1-(4-chlorobenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide (PubChem CID 126011452) has the molecular formula C21H19ClF3N3O2 and a molecular weight of 437.85 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126011452 |
| Molecular Formula | C21H19ClF3N3O2 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccccc1C(F)(F)F)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H19ClF3N3O2/c22-17-7-5-15(6-8-17)20(30)28-11-9-14(10-12-28)19(29)27-26-13-16-3-1-2-4-18(16)21(23,24)25/h1-8,13-14H,9-12H2,(H,27,29)/b26-13- |
| InChIKey | FKDDDCDUJFNDRM-ZMFRSBBQSA-N |
| XLogP | 4.36 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|