C22H22F3N3O3 — CID 126011130
1-(3-methoxybenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide (PubChem CID 126011130) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is 1-(3-methoxybenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(3-methoxybenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126011130 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(3-methoxybenzoyl)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCC(C(=O)N/N=C\c3ccccc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-31-18-7-4-6-16(13-18)21(30)28-11-9-15(10-12-28)20(29)27-26-14-17-5-2-3-8-19(17)22(23,24)25/h2-8,13-15H,9-12H2,1H3,(H,27,29)/b26-14- |
| InChIKey | DJKMUQABFRGXAA-WGARJPEWSA-N |
| XLogP | 3.72 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|