C23H27N3O5 — CID 126011002
1-benzoyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126011002) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-benzoyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126011002 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-benzoyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)C2CCN(C(=O)c3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O5/c1-29-19-13-16(14-20(30-2)21(19)31-3)15-24-25-22(27)17-9-11-26(12-10-17)23(28)18-7-5-4-6-8-18/h4-8,13-15,17H,9-12H2,1-3H3,(H,25,27)/b24-15- |
| InChIKey | CJEKYPXOLWZGGY-IWIPYMOSSA-N |
| XLogP | 2.71 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|