C29H31N3O5 — CID 126012354
1-(3,4-dimethoxybenzoyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126012354) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126012354 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(C(=O)N/N=C\c3ccccc3OCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C29H31N3O5/c1-35-26-13-12-23(18-27(26)36-2)29(34)32-16-14-22(15-17-32)28(33)31-30-19-24-10-6-7-11-25(24)37-20-21-8-4-3-5-9-21/h3-13,18-19,22H,14-17,20H2,1-2H3,(H,31,33)/b30-19- |
| InChIKey | KXHSTURMSBUGTN-FSGOGVSDSA-N |
| XLogP | 4.29 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|