C24H30N4O4 — CID 126010765
1-(3,4-dimethoxybenzoyl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]piperidine-4-carboxamide (PubChem CID 126010765) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126010765 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(C(=O)N/N=C\c3ccc(N(C)C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C24H30N4O4/c1-27(2)20-8-5-17(6-9-20)16-25-26-23(29)18-11-13-28(14-12-18)24(30)19-7-10-21(31-3)22(15-19)32-4/h5-10,15-16,18H,11-14H2,1-4H3,(H,26,29)/b25-16- |
| InChIKey | AUOHGBZIUZIZNX-XYGWBWBKSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|