C24H27N3O6 — CID 3349670
methyl 4-[[[1-(3,5-dimethoxybenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 3349670) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 4-[[[1-(3,5-dimethoxybenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[1-(3,5-dimethoxybenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3349670 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | methyl 4-[[[1-(3,5-dimethoxybenzoyl)piperidine-4-carbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)C2CCN(C(=O)c3cc(OC)cc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O6/c1-31-20-12-19(13-21(14-20)32-2)23(29)27-10-8-17(9-11-27)22(28)26-25-15-16-4-6-18(7-5-16)24(30)33-3/h4-7,12-15,17H,8-11H2,1-3H3,(H,26,28) |
| InChIKey | RCMUSDVHAOZYNP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|