C25H31N3O7 — CID 126011029
1-(3,4-dimethoxybenzoyl)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126011029) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126011029 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(C(=O)N/N=C\c3cc(OC)c(OC)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C25H31N3O7/c1-31-19-7-6-18(14-20(19)32-2)25(30)28-10-8-17(9-11-28)24(29)27-26-15-16-12-21(33-3)23(35-5)22(13-16)34-4/h6-7,12-15,17H,8-11H2,1-5H3,(H,27,29)/b26-15- |
| InChIKey | CSWKTFOUGBRCMU-YSMPRRRNSA-N |
| XLogP | 2.73 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|