C24H18ClF4N3O7S — CID 89115248
(2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-4-(3,5-difluoro-4-hydroxybenzoyl)-N-hydroxypiperazine-2-carboxamide (PubChem CID 89115248) has the molecular formula C24H18ClF4N3O7S and a molecular weight of 603.93 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-4-(3,5-difluoro-4-hydroxybenzoyl)-N-hydroxypiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-4-(3,5-difluoro-4-hydroxybenzoyl)-N-hydroxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 89115248 |
| Molecular Formula | C24H18ClF4N3O7S |
| Molecular Weight | 603.93 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-4-(3,5-difluoro-4-hydroxybenzoyl)-N-hydroxypiperazine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CN(C(=O)c2cc(F)c(O)c(F)c2)CCN1S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C24H18ClF4N3O7S/c25-13-1-3-14(4-2-13)39-22-18(28)9-15(10-19(22)29)40(37,38)32-6-5-31(11-20(32)23(34)30-36)24(35)12-7-16(26)21(33)17(27)8-12/h1-4,7-10,20,33,36H,5-6,11H2,(H,30,34)/t20-/m1/s1 |
| InChIKey | IZSRTKGRZUVQTM-HXUWFJFHSA-N |
| XLogP | 3.41 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|