C19H25Cl3N6O4S — CID 70281805
(2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonyl-[(4-hydroxyphenyl)methyl]amino]-5-(diaminomethylideneamino)pentanamide;hydrochloride (PubChem CID 70281805) has the molecular formula C19H25Cl3N6O4S and a molecular weight of 539.87 g/mol. Its IUPAC name is (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonyl-[(4-hydroxyphenyl)methyl]amino]-5-(diaminomethylideneamino)pentanamide;hydrochloride.
| Compound Name | (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonyl-[(4-hydroxyphenyl)methyl]amino]-5-(diaminomethylideneamino)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 70281805 |
| Molecular Formula | C19H25Cl3N6O4S |
| Molecular Weight | 539.87 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonyl-[(4-hydroxyphenyl)methyl]amino]-5-(diaminomethylideneamino)pentanamide;hydrochloride |
| SMILES | Cl.NC(=O)[C@@H](CCCN=C(N)N)N(Cc1ccc(O)cc1)S(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H24Cl2N6O4S.ClH/c20-14-8-13(9-15(21)17(14)22)32(30,31)27(10-11-3-5-12(28)6-4-11)16(18(23)29)2-1-7-26-19(24)25;/h3-6,8-9,16,28H,1-2,7,10,22H2,(H2,23,29)(H4,24,25,26);1H/t16-;/m1./s1 |
| InChIKey | DBXPCQCHUDYOSH-PKLMIRHRSA-N |
| XLogP | 1.80 |
| TPSA | 191.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.87 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|