C17H30N6O2 — CID 134462647
(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(ethylamino)pentyl]amino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 134462647) has the molecular formula C17H30N6O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(ethylamino)pentyl]amino]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(ethylamino)pentyl]amino]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 134462647 |
| Molecular Formula | C17H30N6O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(ethylamino)pentyl]amino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CCN[C@@H](CCCN=C(N)N)CN[C@@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C17H30N6O2/c1-2-21-13(4-3-9-22-17(19)20)11-23-15(16(18)25)10-12-5-7-14(24)8-6-12/h5-8,13,15,21,23-24H,2-4,9-11H2,1H3,(H2,18,25)(H4,19,20,22)/t13-,15-/m0/s1 |
| InChIKey | PBIFKCRYWACSAQ-ZFWWWQNUSA-N |
| XLogP | -0.59 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|