C22H36N6O6 — CID 10184324
acetic acid;N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(2,2-dimethylpropanoylamino)pentanamide (PubChem CID 10184324) has the molecular formula C22H36N6O6 and a molecular weight of 480.57 g/mol. Its IUPAC name is acetic acid;N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(2,2-dimethylpropanoylamino)pentanamide.
| Compound Name | acetic acid;N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(2,2-dimethylpropanoylamino)pentanamide |
|---|---|
| PubChem CID | 10184324 |
| Molecular Formula | C22H36N6O6 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | acetic acid;N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(2,2-dimethylpropanoylamino)pentanamide |
| SMILES | CC(=O)O.CC(C)(C)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C20H32N6O4.C2H4O2/c1-20(2,3)18(30)26-14(5-4-10-24-19(22)23)17(29)25-15(16(21)28)11-12-6-8-13(27)9-7-12;1-2(3)4/h6-9,14-15,27H,4-5,10-11H2,1-3H3,(H2,21,28)(H,25,29)(H,26,30)(H4,22,23,24);1H3,(H,3,4) |
| InChIKey | IYQNQZQUITWGFH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|