C27H30N6O5 — CID 139693006
(2S)-2-[(2,2-diphenylacetyl)amino]-N-[(3-hydroxyphenyl)methyl]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide (PubChem CID 139693006) has the molecular formula C27H30N6O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(3-hydroxyphenyl)methyl]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide.
| Compound Name | (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(3-hydroxyphenyl)methyl]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide |
|---|---|
| PubChem CID | 139693006 |
| Molecular Formula | C27H30N6O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(3-hydroxyphenyl)methyl]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide |
| SMILES | NC(=N[N+](=O)[O-])NCCC[C@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1cccc(O)c1 |
| InChI | InChI=1S/C27H30N6O5/c28-27(32-33(37)38)29-16-8-15-23(25(35)30-18-19-9-7-14-22(34)17-19)31-26(36)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-7,9-14,17,23-24,34H,8,15-16,18H2,(H,30,35)(H,31,36)(H3,28,29,32)/t23-/m0/s1 |
| InChIKey | VSKMRUJRBOPDBG-QHCPKHFHSA-N |
| XLogP | 2.20 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|