C11H17NO6 — CID 34175728
ethyl (3S,4R)-1-(2-ethoxy-2-oxoethyl)-4-hydroxy-2-oxopyrrolidine-3-carboxylate (PubChem CID 34175728) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl (3S,4R)-1-(2-ethoxy-2-oxoethyl)-4-hydroxy-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-1-(2-ethoxy-2-oxoethyl)-4-hydroxy-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 34175728 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | ethyl (3S,4R)-1-(2-ethoxy-2-oxoethyl)-4-hydroxy-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)CN1C[C@H](O)[C@H](C(=O)OCC)C1=O |
| InChI | InChI=1S/C11H17NO6/c1-3-17-8(14)6-12-5-7(13)9(10(12)15)11(16)18-4-2/h7,9,13H,3-6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | YHVCMAOCJVOQEI-CBAPKCEASA-N |
| XLogP | -1.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|