C9H16N2O3S — CID 86739550
ethyl 2-(5-amino-4-oxo-1,3-thiazepan-3-yl)acetate (PubChem CID 86739550) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is ethyl 2-(5-amino-4-oxo-1,3-thiazepan-3-yl)acetate.
| Compound Name | ethyl 2-(5-amino-4-oxo-1,3-thiazepan-3-yl)acetate |
|---|---|
| PubChem CID | 86739550 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl 2-(5-amino-4-oxo-1,3-thiazepan-3-yl)acetate |
| SMILES | CCOC(=O)CN1CSCCC(N)C1=O |
| InChI | InChI=1S/C9H16N2O3S/c1-2-14-8(12)5-11-6-15-4-3-7(10)9(11)13/h7H,2-6,10H2,1H3 |
| InChIKey | VIGFWCTZQLSDMC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |