C11H21NO3 — CID 25113400
ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoate (PubChem CID 25113400) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoate.
| Compound Name | ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 25113400 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoate |
| SMILES | CCOC(=O)CCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C11H21NO3/c1-4-14-11(13)5-6-12-7-9(2)15-10(3)8-12/h9-10H,4-8H2,1-3H3/t9-,10+ |
| InChIKey | PQHKGZQMAHHJTD-AOOOYVTPSA-N |
| XLogP | 1.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |