C13H25N3O3S — CID 2824618
ethyl N-[3-(2,6-dimethylmorpholin-4-yl)propylcarbamothioyl]carbamate (PubChem CID 2824618) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is ethyl N-[3-(2,6-dimethylmorpholin-4-yl)propylcarbamothioyl]carbamate.
| Compound Name | ethyl N-[3-(2,6-dimethylmorpholin-4-yl)propylcarbamothioyl]carbamate |
|---|---|
| PubChem CID | 2824618 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethyl N-[3-(2,6-dimethylmorpholin-4-yl)propylcarbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C13H25N3O3S/c1-4-18-13(17)15-12(20)14-6-5-7-16-8-10(2)19-11(3)9-16/h10-11H,4-9H2,1-3H3,(H2,14,15,17,20) |
| InChIKey | VUKIBZPCSFMPDM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|