C14H28N2O3 — CID 97039119
(2R)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-2-methoxypropanamide (PubChem CID 97039119) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-2-methoxypropanamide.
| Compound Name | (2R)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 97039119 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (2R)-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-2-methoxypropanamide |
| SMILES | CO[C@H](C)C(=O)NCCCCN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H28N2O3/c1-11-9-16(10-12(2)19-11)8-6-5-7-15-14(17)13(3)18-4/h11-13H,5-10H2,1-4H3,(H,15,17)/t11-,12-,13+/m0/s1 |
| InChIKey | CUBSDDODTHRBQN-RWMBFGLXSA-N |
| XLogP | 1.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|