C12H26N2O3S — CID 97058705
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]ethanesulfonamide (PubChem CID 97058705) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]ethanesulfonamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]ethanesulfonamide |
|---|---|
| PubChem CID | 97058705 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCCN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-4-18(15,16)13-7-5-6-8-14-9-11(2)17-12(3)10-14/h11-13H,4-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | XTUKZVSYZBRSGE-RYUDHWBXSA-N |
| XLogP | 0.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|