C18H15N3O2 — CID 102589138
1,2-dibenzyl-3,5-dioxopyrazolidine-4-carbonitrile (PubChem CID 102589138) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 1,2-dibenzyl-3,5-dioxopyrazolidine-4-carbonitrile.
| Compound Name | 1,2-dibenzyl-3,5-dioxopyrazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 102589138 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1,2-dibenzyl-3,5-dioxopyrazolidine-4-carbonitrile |
| SMILES | N#CC1C(=O)N(Cc2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H15N3O2/c19-11-16-17(22)20(12-14-7-3-1-4-8-14)21(18(16)23)13-15-9-5-2-6-10-15/h1-10,16H,12-13H2 |
| InChIKey | QPQKQDUZDVBZPO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|