C15H16N3O2+ — CID 71651287
3-benzyl-2,4-dioxo-1-propan-2-yl-5H-pyrimidin-1-ium-5-carbonitrile (PubChem CID 71651287) has the molecular formula C15H16N3O2+ and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-benzyl-2,4-dioxo-1-propan-2-yl-5H-pyrimidin-1-ium-5-carbonitrile.
| Compound Name | 3-benzyl-2,4-dioxo-1-propan-2-yl-5H-pyrimidin-1-ium-5-carbonitrile |
|---|---|
| PubChem CID | 71651287 |
| Molecular Formula | C15H16N3O2+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-benzyl-2,4-dioxo-1-propan-2-yl-5H-pyrimidin-1-ium-5-carbonitrile |
| SMILES | CC(C)[N+]1=CC(C#N)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N3O2/c1-11(2)17-10-13(8-16)14(19)18(15(17)20)9-12-6-4-3-5-7-12/h3-7,10-11,13H,9H2,1-2H3/q+1 |
| InChIKey | PNGSORYCEDPDML-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|