About ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane
ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane (PubChem CID 158483667) has the molecular formula C24H28FNO4
and a molecular weight of 413.49 g/mol. Its IUPAC name is ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane.
Molecular Properties
| Compound Name | ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane |
| PubChem CID | 158483667 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane |
| SMILES | C1CCOC1.CCOC(=O)C1(c2ccc(F)cc2)CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H20FNO3.C4H8O/c1-2-25-19(24)20(16-8-10-17(21)11-9-16)12-18(23)22(14-20)13-15-6-4-3-5-7-15;1-2-4-5-3-1/h3-11H,2,12-14H2,1H3;1-4H2 |
| InChIKey | HHVCAHLTYJUQFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane?
The IUPAC name of ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane (CID 158483667) is ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane.
What is the SMILES notation for ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane?
The canonical SMILES for ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane is C1CCOC1.CCOC(=O)C1(c2ccc(F)cc2)CC(=O)N(Cc2ccccc2)C1.
What is the InChIKey of ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane?
The InChIKey is HHVCAHLTYJUQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO3.C4H8O/c1-2-25-19(24)20(16-8-10-17(21)11-9-16)12-18(23)22(14-20)13-15-6-4-3-5-7-15;1-2-4-5-3-1/h3-11H,2,12-14H2,1H3;1-4H2.
What are the key properties of ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane?
ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane has a molecular weight of 413.49 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-3-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate;oxolane is sourced from PubChem (CID 158483667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).