C19H17F2NO4 — CID 144617375
ethyl 2-[5,5-bis(4-fluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]acetate (PubChem CID 144617375) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is ethyl 2-[5,5-bis(4-fluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5,5-bis(4-fluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 144617375 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl 2-[5,5-bis(4-fluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1CC(c2ccc(F)cc2)(c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C19H17F2NO4/c1-2-25-17(23)11-22-12-19(26-18(22)24,13-3-7-15(20)8-4-13)14-5-9-16(21)10-6-14/h3-10H,2,11-12H2,1H3 |
| InChIKey | LNTRDBSIYMAPRA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |