C28H30N2O4 — CID 102013692
ethyl (2R,4R,5R,6R)-8-benzyl-3,11-dimethyl-13-oxo-5-phenyl-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate (PubChem CID 102013692) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl (2R,4R,5R,6R)-8-benzyl-3,11-dimethyl-13-oxo-5-phenyl-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate.
| Compound Name | ethyl (2R,4R,5R,6R)-8-benzyl-3,11-dimethyl-13-oxo-5-phenyl-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate |
|---|---|
| PubChem CID | 102013692 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethyl (2R,4R,5R,6R)-8-benzyl-3,11-dimethyl-13-oxo-5-phenyl-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccccc2)[C@@H]2CN(Cc3ccccc3)c3cc(C)oc(=O)c3[C@@H]2N1C |
| InChI | InChI=1S/C28H30N2O4/c1-4-33-28(32)26-23(20-13-9-6-10-14-20)21-17-30(16-19-11-7-5-8-12-19)22-15-18(2)34-27(31)24(22)25(21)29(26)3/h5-15,21,23,25-26H,4,16-17H2,1-3H3/t21-,23-,25+,26+/m0/s1 |
| InChIKey | GTVUOIVVVBJQPE-AAOIWRJWSA-N |
| XLogP | 4.29 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |