C28H32N4O4 — CID 10005724
ethyl (2R,4R,6R)-3,8-dibenzyl-10,12-dimethyl-11,13-dioxo-3,8,10,12-tetrazatricyclo[7.4.0.02,6]tridec-1(9)-ene-4-carboxylate (PubChem CID 10005724) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is ethyl (2R,4R,6R)-3,8-dibenzyl-10,12-dimethyl-11,13-dioxo-3,8,10,12-tetrazatricyclo[7.4.0.02,6]tridec-1(9)-ene-4-carboxylate.
| Compound Name | ethyl (2R,4R,6R)-3,8-dibenzyl-10,12-dimethyl-11,13-dioxo-3,8,10,12-tetrazatricyclo[7.4.0.02,6]tridec-1(9)-ene-4-carboxylate |
|---|---|
| PubChem CID | 10005724 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | ethyl (2R,4R,6R)-3,8-dibenzyl-10,12-dimethyl-11,13-dioxo-3,8,10,12-tetrazatricyclo[7.4.0.02,6]tridec-1(9)-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]2CN(Cc3ccccc3)c3c(c(=O)n(C)c(=O)n3C)[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C28H32N4O4/c1-4-36-27(34)22-15-21-18-31(16-19-11-7-5-8-12-19)25-23(26(33)30(3)28(35)29(25)2)24(21)32(22)17-20-13-9-6-10-14-20/h5-14,21-22,24H,4,15-18H2,1-3H3/t21-,22-,24-/m1/s1 |
| InChIKey | RIGDCXJWOHTLHA-CQOQZXRMSA-N |
| XLogP | 2.60 |
| TPSA | 76.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |