C21H22N2O6 — CID 56694859
ethyl 3-(1,3-benzodioxol-5-yl)-1-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 56694859) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxol-5-yl)-1-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | ethyl 3-(1,3-benzodioxol-5-yl)-1-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56694859 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 3-(1,3-benzodioxol-5-yl)-1-methyl-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccc3c(c2)OCO3)C([N+](=O)[O-])C(c2ccccc2)N1C |
| InChI | InChI=1S/C21H22N2O6/c1-3-27-21(24)20-17(14-9-10-15-16(11-14)29-12-28-15)19(23(25)26)18(22(20)2)13-7-5-4-6-8-13/h4-11,17-20H,3,12H2,1-2H3 |
| InChIKey | POLLWOGOMWINIK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|