C16H18O4 — CID 71443761
ethyl 2-(1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxylate (PubChem CID 71443761) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 2-(1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 2-(1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 71443761 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl 2-(1,3-benzodioxol-5-yl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC=CC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18O4/c1-2-18-16(17)13-6-4-3-5-12(13)11-7-8-14-15(9-11)20-10-19-14/h3,5,7-9,12-13H,2,4,6,10H2,1H3 |
| InChIKey | AMWIVMDZDUDPOD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|