C19H26BrNO4 — CID 22322720
ethyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-propylpyrrolidine-3-carboxylate (PubChem CID 22322720) has the molecular formula C19H26BrNO4 and a molecular weight of 412.32 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-propylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-propylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 22322720 |
| Molecular Formula | C19H26BrNO4 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-propylpyrrolidine-3-carboxylate |
| SMILES | CCCC1C(C(=O)OCC)C(c2ccc3c(c2)OCO3)CN1CCBr |
| InChI | InChI=1S/C19H26BrNO4/c1-3-5-15-18(19(22)23-4-2)14(11-21(15)9-8-20)13-6-7-16-17(10-13)25-12-24-16/h6-7,10,14-15,18H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | VIFVSEKWIBTIEG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|