C26H33NO5S — CID 10648093
ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(2-propylsulfanylethyl)pyrrolidine-3-carboxylate (PubChem CID 10648093) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(2-propylsulfanylethyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(2-propylsulfanylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 10648093 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(2-propylsulfanylethyl)pyrrolidine-3-carboxylate |
| SMILES | CCCSCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)OCC)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H33NO5S/c1-4-13-33-14-12-27-16-21(19-8-11-22-23(15-19)32-17-31-22)24(26(28)30-5-2)25(27)18-6-9-20(29-3)10-7-18/h6-11,15,21,24-25H,4-5,12-14,16-17H2,1-3H3/t21-,24-,25+/m0/s1 |
| InChIKey | YWDVHGQDSBMZPC-GVXSCFBNSA-N |
| XLogP | 4.89 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|