C25H31NO5S — CID 10790031
ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2-ethylsulfanylethyl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 10790031) has the molecular formula C25H31NO5S and a molecular weight of 457.59 g/mol. Its IUPAC name is ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2-ethylsulfanylethyl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2-ethylsulfanylethyl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 10790031 |
| Molecular Formula | C25H31NO5S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | ethyl (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2-ethylsulfanylethyl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccc(OC)cc2)N(CCSCC)C[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H31NO5S/c1-4-29-25(27)23-20(18-8-11-21-22(14-18)31-16-30-21)15-26(12-13-32-5-2)24(23)17-6-9-19(28-3)10-7-17/h6-11,14,20,23-24H,4-5,12-13,15-16H2,1-3H3/t20-,23-,24+/m0/s1 |
| InChIKey | DTFZYRHBOFDPDO-NKKJXINNSA-N |
| XLogP | 4.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|