C25H40N2O6S — CID 91350640
(2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(3-pentylsulfonylpropylamino)ethyl]-2-propylpyrrolidine-3-carboxylic acid (PubChem CID 91350640) has the molecular formula C25H40N2O6S and a molecular weight of 496.67 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(3-pentylsulfonylpropylamino)ethyl]-2-propylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(3-pentylsulfonylpropylamino)ethyl]-2-propylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 91350640 |
| Molecular Formula | C25H40N2O6S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(3-pentylsulfonylpropylamino)ethyl]-2-propylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCS(=O)(=O)CCCNCCN1C[C@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1CCC |
| InChI | InChI=1S/C25H40N2O6S/c1-3-5-6-14-34(30,31)15-7-11-26-12-13-27-17-20(24(25(28)29)21(27)8-4-2)19-9-10-22-23(16-19)33-18-32-22/h9-10,16,20-21,24,26H,3-8,11-15,17-18H2,1-2H3,(H,28,29)/t20-,21-,24+/m1/s1 |
| InChIKey | XTCDOQBQJUFFKS-LGVFNWMJSA-N |
| XLogP | 3.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|