C28H47N4O7S+ — CID 20870197
4-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 20870197) has the molecular formula C28H47N4O7S+ and a molecular weight of 583.77 g/mol. Its IUPAC name is 4-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 20870197 |
| Molecular Formula | C28H47N4O7S+ |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | 4-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1CCNS(C)(=O)=O |
| InChI | InChI=1S/C28H46N4O7S/c1-6-7-14-30(15-8-9-16-32(2,3)4)26(33)19-31-18-22(21-10-11-24-25(17-21)39-20-38-24)27(28(34)35)23(31)12-13-29-40(5,36)37/h10-11,17,22-23,27,29H,6-9,12-16,18-20H2,1-5H3/p+1 |
| InChIKey | LPQXPXKTEZXNIZ-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|