C32H52N3O6+ — CID 54046531
4-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(oxan-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 54046531) has the molecular formula C32H52N3O6+ and a molecular weight of 574.78 g/mol. Its IUPAC name is 4-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(oxan-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(oxan-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 54046531 |
| Molecular Formula | C32H52N3O6+ |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | 4-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(oxan-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)C(C(=O)O)[C@@H]1CCC1CCCCO1 |
| InChI | InChI=1S/C32H51N3O6/c1-5-6-16-33(17-8-9-18-35(2,3)4)30(36)22-34-21-26(24-12-15-28-29(20-24)41-23-40-28)31(32(37)38)27(34)14-13-25-11-7-10-19-39-25/h12,15,20,25-27,31H,5-11,13-14,16-19,21-23H2,1-4H3/p+1/t25?,26-,27+,31?/m1/s1 |
| InChIKey | LPYICTJAWNJZRC-YIORGNESSA-O |
| XLogP | 4.35 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|