C30H46N5O5+ — CID 58848364
4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2-imidazol-1-ylethyl)pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 58848364) has the molecular formula C30H46N5O5+ and a molecular weight of 556.73 g/mol. Its IUPAC name is 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2-imidazol-1-ylethyl)pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2-imidazol-1-ylethyl)pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 58848364 |
| Molecular Formula | C30H46N5O5+ |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2-imidazol-1-ylethyl)pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1ccnc1 |
| InChI | InChI=1S/C30H45N5O5/c1-5-6-13-33(14-7-8-17-35(2,3)4)28(36)20-34-19-24(23-9-10-26-27(18-23)40-22-39-26)29(30(37)38)25(34)11-15-32-16-12-31-21-32/h9-10,12,16,18,21,24-25,29H,5-8,11,13-15,17,19-20,22H2,1-4H3/p+1/t24-,25+,29-/m1/s1 |
| InChIKey | KCLYVDXFEOJJGF-BEYSDYMESA-O |
| XLogP | 3.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|