C35H49N4O6+ — CID 91010953
4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(1-hydroxyisoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 91010953) has the molecular formula C35H49N4O6+ and a molecular weight of 621.80 g/mol. Its IUPAC name is 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(1-hydroxyisoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(1-hydroxyisoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 91010953 |
| Molecular Formula | C35H49N4O6+ |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(1-hydroxyisoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1cc2ccccc2c1O |
| InChI | InChI=1S/C35H48N4O6/c1-5-6-16-36(17-9-10-19-39(2,3)4)32(40)23-38-22-28(25-13-14-30-31(20-25)45-24-44-30)33(35(42)43)29(38)15-18-37-21-26-11-7-8-12-27(26)34(37)41/h7-8,11-14,20-21,28-29,33H,5-6,9-10,15-19,22-24H2,1-4H3,(H-,41,42,43)/p+1/t28-,29+,33-/m1/s1 |
| InChIKey | NIQXERUDMJPEPE-ZLWRCJDJSA-O |
| XLogP | 4.75 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|