C31H47N4O7+ — CID 58847785
4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 58847785) has the molecular formula C31H47N4O7+ and a molecular weight of 587.74 g/mol. Its IUPAC name is 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 58847785 |
| Molecular Formula | C31H47N4O7+ |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C31H46N4O7/c1-5-6-14-32(15-7-8-17-35(2,3)4)29(38)20-33-19-23(22-9-10-25-26(18-22)42-21-41-25)30(31(39)40)24(33)13-16-34-27(36)11-12-28(34)37/h9-10,18,23-24,30H,5-8,11-17,19-21H2,1-4H3/p+1/t23-,24+,30-/m1/s1 |
| InChIKey | AXMJNQZWBOMCIY-FSGGQHMVSA-O |
| XLogP | 2.54 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|