C30H45N4O7+ — CID 20869887
3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium (PubChem CID 20869887) has the molecular formula C30H45N4O7+ and a molecular weight of 573.71 g/mol. Its IUPAC name is 3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium.
| Compound Name | 3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 20869887 |
| Molecular Formula | C30H45N4O7+ |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | 3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium |
| SMILES | CCCCN(CCC[N+](C)(C)C)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C30H44N4O7/c1-5-6-13-31(14-7-16-34(2,3)4)28(37)19-32-18-22(21-8-9-24-25(17-21)41-20-40-24)29(30(38)39)23(32)12-15-33-26(35)10-11-27(33)36/h8-9,17,22-23,29H,5-7,10-16,18-20H2,1-4H3/p+1 |
| InChIKey | FGVRJRDJLJYUIQ-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|