C32H50N5O6+ — CID 58848606
3-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-methyl-2,6-dioxo-1,3-diazinan-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]propyl-trimethylazanium (PubChem CID 58848606) has the molecular formula C32H50N5O6+ and a molecular weight of 600.78 g/mol. Its IUPAC name is 3-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-methyl-2,6-dioxo-1,3-diazinan-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-methyl-2,6-dioxo-1,3-diazinan-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58848606 |
| Molecular Formula | C32H50N5O6+ |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 3-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-methyl-2,6-dioxo-1,3-diazinan-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]propyl-trimethylazanium |
| SMILES | CCCCN(CCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1CCN1C(=O)CCN(C)C1=O |
| InChI | InChI=1S/C32H49N5O6/c1-6-7-14-34(15-8-18-37(3,4)5)29(39)22-35-21-25(23-9-10-27-24(20-23)13-19-43-27)30(31(40)41)26(35)11-17-36-28(38)12-16-33(2)32(36)42/h9-10,20,25-26,30H,6-8,11-19,21-22H2,1-5H3/p+1/t25-,26+,30-/m1/s1 |
| InChIKey | GVCLXNNZPAGWMV-DIIXFEDBSA-O |
| XLogP | 2.49 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|