C32H51N4O5+ — CID 20870512
4-[butyl-[2-[3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 20870512) has the molecular formula C32H51N4O5+ and a molecular weight of 571.78 g/mol. Its IUPAC name is 4-[butyl-[2-[3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 20870512 |
| Molecular Formula | C32H51N4O5+ |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.39 |
| IUPAC Name | 4-[butyl-[2-[3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-oxopyrrolidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1CC(c2ccc3c(c2)CCO3)C(C(=O)O)C1CCN1CCCC1=O |
| InChI | InChI=1S/C32H50N4O5/c1-5-6-15-33(16-7-8-19-36(2,3)4)30(38)23-35-22-26(24-11-12-28-25(21-24)14-20-41-28)31(32(39)40)27(35)13-18-34-17-9-10-29(34)37/h11-12,21,26-27,31H,5-10,13-20,22-23H2,1-4H3/p+1 |
| InChIKey | YZIKOOKHGQMDTP-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|