C36H51N4O5+ — CID 58848001
4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-oxo-1H-isoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 58848001) has the molecular formula C36H51N4O5+ and a molecular weight of 619.83 g/mol. Its IUPAC name is 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-oxo-1H-isoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-oxo-1H-isoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 58848001 |
| Molecular Formula | C36H51N4O5+ |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.39 |
| IUPAC Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(3-oxo-1H-isoindol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1CCN1Cc2ccccc2C1=O |
| InChI | InChI=1S/C36H50N4O5/c1-5-6-17-37(18-9-10-20-40(2,3)4)33(41)25-39-24-30(26-13-14-32-27(22-26)16-21-45-32)34(36(43)44)31(39)15-19-38-23-28-11-7-8-12-29(28)35(38)42/h7-8,11-14,22,30-31,34H,5-6,9-10,15-21,23-25H2,1-4H3/p+1/t30-,31+,34-/m1/s1 |
| InChIKey | XIZHBOPDVFLHOW-JSWXEYCZSA-O |
| XLogP | 4.25 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|