C35H52N3O6+ — CID 54358992
4-[butyl-[2-[(2S,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-methoxyphenoxy)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 54358992) has the molecular formula C35H52N3O6+ and a molecular weight of 610.82 g/mol. Its IUPAC name is 4-[butyl-[2-[(2S,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-methoxyphenoxy)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[(2S,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-methoxyphenoxy)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 54358992 |
| Molecular Formula | C35H52N3O6+ |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | 4-[butyl-[2-[(2S,4S)-3-carboxy-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[2-(2-methoxyphenoxy)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)C(C(=O)O)[C@@H]1CCOc1ccccc1OC |
| InChI | InChI=1S/C35H51N3O6/c1-6-7-18-36(19-10-11-20-38(2,3)4)33(39)25-37-24-28(26-14-15-30-27(23-26)16-21-43-30)34(35(40)41)29(37)17-22-44-32-13-9-8-12-31(32)42-5/h8-9,12-15,23,28-29,34H,6-7,10-11,16-22,24-25H2,1-5H3/p+1/t28-,29+,34?/m1/s1 |
| InChIKey | ULDCADWDRWJRRG-NIEPVDEBSA-O |
| XLogP | 4.68 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|