C34H48N3O7+ — CID 20870173
4-[[2-[4-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-4-yl)ethyl]-3-carboxypyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 20870173) has the molecular formula C34H48N3O7+ and a molecular weight of 610.77 g/mol. Its IUPAC name is 4-[[2-[4-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-4-yl)ethyl]-3-carboxypyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[4-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-4-yl)ethyl]-3-carboxypyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 20870173 |
| Molecular Formula | C34H48N3O7+ |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | 4-[[2-[4-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-4-yl)ethyl]-3-carboxypyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1CCc1cccc2c1OCO2 |
| InChI | InChI=1S/C34H47N3O7/c1-5-6-16-35(17-7-8-18-37(2,3)4)31(38)21-36-20-26(25-13-15-28-30(19-25)43-22-41-28)32(34(39)40)27(36)14-12-24-10-9-11-29-33(24)44-23-42-29/h9-11,13,15,19,26-27,32H,5-8,12,14,16-18,20-23H2,1-4H3/p+1 |
| InChIKey | UEVOAQQWICIUKE-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|