C34H48IN2O7- — CID 163759485
CID 163759485 (PubChem CID 163759485) has the molecular formula C34H48IN2O7- and a molecular weight of 723.67 g/mol.
| Compound Name | CID 163759485 |
|---|---|
| PubChem CID | 163759485 |
| Molecular Formula | C34H48IN2O7- |
| Molecular Weight | 723.67 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | — |
| SMILES | CCCCN(CCCC[I-](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1cccc2c1OCO2 |
| InChI | InChI=1S/C34H48IN2O7/c1-5-6-17-36(18-8-7-16-35(2,3)4)31(38)21-37-20-26(25-13-15-28-30(19-25)43-22-41-28)32(34(39)40)27(37)14-12-24-10-9-11-29-33(24)44-23-42-29/h9-11,13,15,19,26-27,32H,5-8,12,14,16-18,20-23H2,1-4H3,(H,39,40)/q-1/t26-,27+,32-/m1/s1 |
| InChIKey | OPJWTXGAWGDKKF-BZNBAONSSA-N |
| XLogP | 1.70 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|