C25H40N4O6S — CID 89281778
N-(4-aminobutyl)-2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]-N-butylacetamide (PubChem CID 89281778) has the molecular formula C25H40N4O6S and a molecular weight of 524.68 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]-N-butylacetamide.
| Compound Name | N-(4-aminobutyl)-2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 89281778 |
| Molecular Formula | C25H40N4O6S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | N-(4-aminobutyl)-2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(methanesulfonamido)ethyl]pyrrolidin-1-yl]-N-butylacetamide |
| SMILES | CCCCN(CCCCN)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C=O)[C@@H]1CCNS(C)(=O)=O |
| InChI | InChI=1S/C25H40N4O6S/c1-3-4-12-28(13-6-5-10-26)25(31)16-29-15-20(19-7-8-23-24(14-19)35-18-34-23)21(17-30)22(29)9-11-27-36(2,32)33/h7-8,14,17,20-22,27H,3-6,9-13,15-16,18,26H2,1-2H3/t20-,21-,22+/m1/s1 |
| InChIKey | RQBSXBTUCVZRJK-VSKRKVRLSA-N |
| XLogP | 1.31 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|