C31H48N5O4+ — CID 89281572
4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium (PubChem CID 89281572) has the molecular formula C31H48N5O4+ and a molecular weight of 554.76 g/mol. Its IUPAC name is 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium.
| Compound Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 89281572 |
| Molecular Formula | C31H48N5O4+ |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 4-[[2-[(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-3-formyl-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]-butylamino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C=O)[C@@H]1CCc1nccn1C |
| InChI | InChI=1S/C31H48N5O4/c1-6-7-15-34(16-8-9-18-36(3,4)5)31(38)21-35-20-25(24-10-12-28-29(19-24)40-23-39-28)26(22-37)27(35)11-13-30-32-14-17-33(30)2/h10,12,14,17,19,22,25-27H,6-9,11,13,15-16,18,20-21,23H2,1-5H3/q+1/t25-,26-,27+/m1/s1 |
| InChIKey | MADWFIYICNKKJY-PFBJBMPXSA-N |
| XLogP | 3.48 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|